C12H16O7S-2 — CID 126961020
2-[(1R,2S)-3-oxo-2-[(Z)-5-sulfonatooxypent-2-enyl]cyclopentyl]acetate (PubChem CID 126961020) has the molecular formula C12H16O7S-2 and a molecular weight of 304.32 g/mol. Its IUPAC name is 2-[(1R,2S)-3-oxo-2-[(Z)-5-sulfonatooxypent-2-enyl]cyclopentyl]acetate.
| Compound Name | 2-[(1R,2S)-3-oxo-2-[(Z)-5-sulfonatooxypent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 126961020 |
| Molecular Formula | C12H16O7S-2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-[(1R,2S)-3-oxo-2-[(Z)-5-sulfonatooxypent-2-enyl]cyclopentyl]acetate |
| SMILES | O=C([O-])C[C@H]1CCC(=O)[C@H]1C/C=C\CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H18O7S/c13-11-6-5-9(8-12(14)15)10(11)4-2-1-3-7-19-20(16,17)18/h1-2,9-10H,3-8H2,(H,14,15)(H,16,17,18)/p-2/b2-1-/t9-,10+/m1/s1 |
| InChIKey | MLUJBNROAVANKK-SZXTZRQCSA-L |
| XLogP | -0.47 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|