C17H20N2O4 — CID 126961330
3-[2-(hydroxyamino)-5-[(1S)-1-hydroxyethyl]phenoxy]-N,N-dimethylbenzamide (PubChem CID 126961330) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-[2-(hydroxyamino)-5-[(1S)-1-hydroxyethyl]phenoxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[2-(hydroxyamino)-5-[(1S)-1-hydroxyethyl]phenoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 126961330 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-[2-(hydroxyamino)-5-[(1S)-1-hydroxyethyl]phenoxy]-N,N-dimethylbenzamide |
| SMILES | C[C@H](O)c1ccc(NO)c(Oc2cccc(C(=O)N(C)C)c2)c1 |
| InChI | InChI=1S/C17H20N2O4/c1-11(20)12-7-8-15(18-22)16(10-12)23-14-6-4-5-13(9-14)17(21)19(2)3/h4-11,18,20,22H,1-3H3/t11-/m0/s1 |
| InChIKey | YIOUWEBZKIOOOI-NSHDSACASA-N |
| XLogP | 3.04 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|