C14H13FN2O2 — CID 23441684
3-[(6-fluoro-2-pyridinyl)oxy]-N,N-dimethylbenzamide (PubChem CID 23441684) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 3-[(6-fluoro-2-pyridinyl)oxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[(6-fluoro-2-pyridinyl)oxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 23441684 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 3-[(6-fluoro-2-pyridinyl)oxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Oc2cccc(F)n2)c1 |
| InChI | InChI=1S/C14H13FN2O2/c1-17(2)14(18)10-5-3-6-11(9-10)19-13-8-4-7-12(15)16-13/h3-9H,1-2H3 |
| InChIKey | RQHQWCNNVKIWAI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|