C22H16N4O3 — CID 10596169
2,6-bis(3-cyanophenoxy)-N,N-dimethylpyridine-3-carboxamide (PubChem CID 10596169) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 2,6-bis(3-cyanophenoxy)-N,N-dimethylpyridine-3-carboxamide.
| Compound Name | 2,6-bis(3-cyanophenoxy)-N,N-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 10596169 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2,6-bis(3-cyanophenoxy)-N,N-dimethylpyridine-3-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2cccc(C#N)c2)nc1Oc1cccc(C#N)c1 |
| InChI | InChI=1S/C22H16N4O3/c1-26(2)22(27)19-9-10-20(28-17-7-3-5-15(11-17)13-23)25-21(19)29-18-8-4-6-16(12-18)14-24/h3-12H,1-2H3 |
| InChIKey | BHSSAMRMOWSDHP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 99.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |