C32H37FN4O2 — CID 126961692
tert-butyl 2-[4-[4-(4-fluoro-8-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-11-yl)-3,6-dihydro-2H-pyridin-1-yl]cyclohexylidene]acetate (PubChem CID 126961692) has the molecular formula C32H37FN4O2 and a molecular weight of 528.67 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-(4-fluoro-8-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-11-yl)-3,6-dihydro-2H-pyridin-1-yl]cyclohexylidene]acetate.
| Compound Name | tert-butyl 2-[4-[4-(4-fluoro-8-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-11-yl)-3,6-dihydro-2H-pyridin-1-yl]cyclohexylidene]acetate |
|---|---|
| PubChem CID | 126961692 |
| Molecular Formula | C32H37FN4O2 |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | tert-butyl 2-[4-[4-(4-fluoro-8-methyl-8,12,14-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(17),2(7),3,5,10,13,15-heptaen-11-yl)-3,6-dihydro-2H-pyridin-1-yl]cyclohexylidene]acetate |
| SMILES | CN1Cc2c(C3=CCN(C4CCC(=CC(=O)OC(C)(C)C)CC4)CC3)[nH]c3nccc(c23)-c2cc(F)ccc21 |
| InChI | InChI=1S/C32H37FN4O2/c1-32(2,3)39-28(38)17-20-5-8-23(9-6-20)37-15-12-21(13-16-37)30-26-19-36(4)27-10-7-22(33)18-25(27)24-11-14-34-31(35-30)29(24)26/h7,10-12,14,17-18,23H,5-6,8-9,13,15-16,19H2,1-4H3,(H,34,35)/b20-17- |
| InChIKey | IYKRFQVMTKKRBS-JZJYNLBNSA-N |
| XLogP | 6.62 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|