C16H17F3O2S — CID 126961915
methyl 2-[(E)-2-(4-methylphenyl)ethenyl]-2-(trifluoromethylsulfanyl)pent-4-enoate (PubChem CID 126961915) has the molecular formula C16H17F3O2S and a molecular weight of 330.37 g/mol. Its IUPAC name is methyl 2-[(E)-2-(4-methylphenyl)ethenyl]-2-(trifluoromethylsulfanyl)pent-4-enoate.
| Compound Name | methyl 2-[(E)-2-(4-methylphenyl)ethenyl]-2-(trifluoromethylsulfanyl)pent-4-enoate |
|---|---|
| PubChem CID | 126961915 |
| Molecular Formula | C16H17F3O2S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | methyl 2-[(E)-2-(4-methylphenyl)ethenyl]-2-(trifluoromethylsulfanyl)pent-4-enoate |
| SMILES | C=CCC(/C=C/c1ccc(C)cc1)(SC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C16H17F3O2S/c1-4-10-15(14(20)21-3,22-16(17,18)19)11-9-13-7-5-12(2)6-8-13/h4-9,11H,1,10H2,2-3H3/b11-9+ |
| InChIKey | FEIONWMJOAFGMR-PKNBQFBNSA-N |
| XLogP | 4.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|