C24H28N8O2 — CID 126962038
8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-(quinazolin-2-ylmethyl)-4,5-dihydropurine-2,6-dione (PubChem CID 126962038) has the molecular formula C24H28N8O2 and a molecular weight of 460.54 g/mol. Its IUPAC name is 8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-(quinazolin-2-ylmethyl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-(quinazolin-2-ylmethyl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 126962038 |
| Molecular Formula | C24H28N8O2 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 8-[(3R)-3-aminopiperidin-1-yl]-7-but-2-ynyl-3-methyl-1-(quinazolin-2-ylmethyl)-4,5-dihydropurine-2,6-dione |
| SMILES | CC#CCN1C(N2CCC[C@@H](N)C2)=NC2C1C(=O)N(Cc1ncc3ccccc3n1)C(=O)N2C |
| InChI | InChI=1S/C24H28N8O2/c1-3-4-12-31-20-21(28-23(31)30-11-7-9-17(25)14-30)29(2)24(34)32(22(20)33)15-19-26-13-16-8-5-6-10-18(16)27-19/h5-6,8,10,13,17,20-21H,7,9,11-12,14-15,25H2,1-2H3/t17-,20?,21?/m1/s1 |
| InChIKey | XUCLJDGNGBEUQQ-MDMXATFFSA-N |
| XLogP | 0.84 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|