C25H21Cl2FN6O2 — CID 126963182
N-(3-aminopropyl)-5-[[2,4-dichloro-5-(5-fluoro-2-pyridinyl)benzoyl]amino]-1-phenylpyrazole-3-carboxamide (PubChem CID 126963182) has the molecular formula C25H21Cl2FN6O2 and a molecular weight of 527.39 g/mol. Its IUPAC name is N-(3-aminopropyl)-5-[[2,4-dichloro-5-(5-fluoro-2-pyridinyl)benzoyl]amino]-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-(3-aminopropyl)-5-[[2,4-dichloro-5-(5-fluoro-2-pyridinyl)benzoyl]amino]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 126963182 |
| Molecular Formula | C25H21Cl2FN6O2 |
| Molecular Weight | 527.39 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | N-(3-aminopropyl)-5-[[2,4-dichloro-5-(5-fluoro-2-pyridinyl)benzoyl]amino]-1-phenylpyrazole-3-carboxamide |
| SMILES | NCCCNC(=O)c1cc(NC(=O)c2cc(-c3ccc(F)cn3)c(Cl)cc2Cl)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H21Cl2FN6O2/c26-19-12-20(27)18(11-17(19)21-8-7-15(28)14-31-21)24(35)32-23-13-22(25(36)30-10-4-9-29)33-34(23)16-5-2-1-3-6-16/h1-3,5-8,11-14H,4,9-10,29H2,(H,30,36)(H,32,35) |
| InChIKey | JJNRSJGKYWYOHC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|