C10H4ClF6N3O — CID 126963652
N-[1-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]-2,2,2-trifluoroethylidene]hydroxylamine (PubChem CID 126963652) has the molecular formula C10H4ClF6N3O and a molecular weight of 331.60 g/mol. Its IUPAC name is N-[1-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]-2,2,2-trifluoroethylidene]hydroxylamine.
| Compound Name | N-[1-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]-2,2,2-trifluoroethylidene]hydroxylamine |
|---|---|
| PubChem CID | 126963652 |
| Molecular Formula | C10H4ClF6N3O |
| Molecular Weight | 331.60 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | N-[1-[8-chloro-6-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]-2,2,2-trifluoroethylidene]hydroxylamine |
| SMILES | ON=C(c1cnc2c(Cl)cc(C(F)(F)F)cn12)C(F)(F)F |
| InChI | InChI=1S/C10H4ClF6N3O/c11-5-1-4(9(12,13)14)3-20-6(2-18-8(5)20)7(19-21)10(15,16)17/h1-3,21H |
| InChIKey | URVFEROXYXOLJR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|