C13H17ClFN3O — CID 126964065
2-[[[1-(2-fluoroethyl)-5-methylpyrazol-4-yl]amino]methyl]phenol;hydrochloride (PubChem CID 126964065) has the molecular formula C13H17ClFN3O and a molecular weight of 285.75 g/mol. Its IUPAC name is 2-[[[1-(2-fluoroethyl)-5-methylpyrazol-4-yl]amino]methyl]phenol;hydrochloride.
| Compound Name | 2-[[[1-(2-fluoroethyl)-5-methylpyrazol-4-yl]amino]methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 126964065 |
| Molecular Formula | C13H17ClFN3O |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[[[1-(2-fluoroethyl)-5-methylpyrazol-4-yl]amino]methyl]phenol;hydrochloride |
| SMILES | Cc1c(NCc2ccccc2O)cnn1CCF.Cl |
| InChI | InChI=1S/C13H16FN3O.ClH/c1-10-12(9-16-17(10)7-6-14)15-8-11-4-2-3-5-13(11)18;/h2-5,9,15,18H,6-8H2,1H3;1H |
| InChIKey | YAHKEIPMYDQVKH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|