C13H18ClN3 — CID 126964810
N-benzyl-1-ethyl-5-methylpyrazol-4-amine;hydrochloride (PubChem CID 126964810) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is N-benzyl-1-ethyl-5-methylpyrazol-4-amine;hydrochloride.
| Compound Name | N-benzyl-1-ethyl-5-methylpyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 126964810 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | N-benzyl-1-ethyl-5-methylpyrazol-4-amine;hydrochloride |
| SMILES | CCn1ncc(NCc2ccccc2)c1C.Cl |
| InChI | InChI=1S/C13H17N3.ClH/c1-3-16-11(2)13(10-15-16)14-9-12-7-5-4-6-8-12;/h4-8,10,14H,3,9H2,1-2H3;1H |
| InChIKey | UBCUELOLRDDIMY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |