C15H24Cl2N4 — CID 126966596
N-[[4-(dimethylamino)phenyl]methyl]-1-ethyl-5-methylpyrazol-4-amine;dihydrochloride (PubChem CID 126966596) has the molecular formula C15H24Cl2N4 and a molecular weight of 331.29 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-1-ethyl-5-methylpyrazol-4-amine;dihydrochloride.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-1-ethyl-5-methylpyrazol-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 126966596 |
| Molecular Formula | C15H24Cl2N4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-1-ethyl-5-methylpyrazol-4-amine;dihydrochloride |
| SMILES | CCn1ncc(NCc2ccc(N(C)C)cc2)c1C.Cl.Cl |
| InChI | InChI=1S/C15H22N4.2ClH/c1-5-19-12(2)15(11-17-19)16-10-13-6-8-14(9-7-13)18(3)4;;/h6-9,11,16H,5,10H2,1-4H3;2*1H |
| InChIKey | KDSFPNWFBBDYJD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|