C11H19ClF3N3 — CID 126964251
N-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]pentan-1-amine;hydrochloride (PubChem CID 126964251) has the molecular formula C11H19ClF3N3 and a molecular weight of 285.74 g/mol. Its IUPAC name is N-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]pentan-1-amine;hydrochloride.
| Compound Name | N-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 126964251 |
| Molecular Formula | C11H19ClF3N3 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]pentan-1-amine;hydrochloride |
| SMILES | CCCCCNCc1cc(C(F)(F)F)n(C)n1.Cl |
| InChI | InChI=1S/C11H18F3N3.ClH/c1-3-4-5-6-15-8-9-7-10(11(12,13)14)17(2)16-9;/h7,15H,3-6,8H2,1-2H3;1H |
| InChIKey | JNEJGRAFVBQNEH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|