C12H16F3N5 — CID 19626309
1-ethyl-3-methyl-N-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]pyrazol-4-amine (PubChem CID 19626309) has the molecular formula C12H16F3N5 and a molecular weight of 287.29 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]pyrazol-4-amine.
| Compound Name | 1-ethyl-3-methyl-N-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]pyrazol-4-amine |
|---|---|
| PubChem CID | 19626309 |
| Molecular Formula | C12H16F3N5 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-ethyl-3-methyl-N-[[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]pyrazol-4-amine |
| SMILES | CCn1cc(NCc2cc(C(F)(F)F)n(C)n2)c(C)n1 |
| InChI | InChI=1S/C12H16F3N5/c1-4-20-7-10(8(2)17-20)16-6-9-5-11(12(13,14)15)19(3)18-9/h5,7,16H,4,6H2,1-3H3 |
| InChIKey | LNCAPMRUKGLMRA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |