C12H19ClFN5 — CID 126964764
N-[(1-ethyl-4-methylpyrazol-5-yl)methyl]-1-(2-fluoroethyl)pyrazol-4-amine;hydrochloride (PubChem CID 126964764) has the molecular formula C12H19ClFN5 and a molecular weight of 287.77 g/mol. Its IUPAC name is N-[(1-ethyl-4-methylpyrazol-5-yl)methyl]-1-(2-fluoroethyl)pyrazol-4-amine;hydrochloride.
| Compound Name | N-[(1-ethyl-4-methylpyrazol-5-yl)methyl]-1-(2-fluoroethyl)pyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 126964764 |
| Molecular Formula | C12H19ClFN5 |
| Molecular Weight | 287.77 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[(1-ethyl-4-methylpyrazol-5-yl)methyl]-1-(2-fluoroethyl)pyrazol-4-amine;hydrochloride |
| SMILES | CCn1ncc(C)c1CNc1cnn(CCF)c1.Cl |
| InChI | InChI=1S/C12H18FN5.ClH/c1-3-18-12(10(2)6-16-18)8-14-11-7-15-17(9-11)5-4-13;/h6-7,9,14H,3-5,8H2,1-2H3;1H |
| InChIKey | SEUBZVCOOTVSPI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.77 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |