C10H15ClFN5 — CID 126967961
1-(2-fluoroethyl)-N-[(1-methylpyrazol-4-yl)methyl]pyrazol-4-amine;hydrochloride (PubChem CID 126967961) has the molecular formula C10H15ClFN5 and a molecular weight of 259.72 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-N-[(1-methylpyrazol-4-yl)methyl]pyrazol-4-amine;hydrochloride.
| Compound Name | 1-(2-fluoroethyl)-N-[(1-methylpyrazol-4-yl)methyl]pyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 126967961 |
| Molecular Formula | C10H15ClFN5 |
| Molecular Weight | 259.72 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-(2-fluoroethyl)-N-[(1-methylpyrazol-4-yl)methyl]pyrazol-4-amine;hydrochloride |
| SMILES | Cl.Cn1cc(CNc2cnn(CCF)c2)cn1 |
| InChI | InChI=1S/C10H14FN5.ClH/c1-15-7-9(5-13-15)4-12-10-6-14-16(8-10)3-2-11;/h5-8,12H,2-4H2,1H3;1H |
| InChIKey | AVSHHBNWFWKHHA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.72 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |