C11H17ClFN5 — CID 126968159
1-(2-fluoroethyl)-4-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazol-5-amine;hydrochloride (PubChem CID 126968159) has the molecular formula C11H17ClFN5 and a molecular weight of 273.74 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-4-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazol-5-amine;hydrochloride.
| Compound Name | 1-(2-fluoroethyl)-4-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 126968159 |
| Molecular Formula | C11H17ClFN5 |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(2-fluoroethyl)-4-methyl-N-[(1-methylpyrazol-4-yl)methyl]pyrazol-5-amine;hydrochloride |
| SMILES | Cc1cnn(CCF)c1NCc1cnn(C)c1.Cl |
| InChI | InChI=1S/C11H16FN5.ClH/c1-9-5-15-17(4-3-12)11(9)13-6-10-7-14-16(2)8-10;/h5,7-8,13H,3-4,6H2,1-2H3;1H |
| InChIKey | IKTPENZNVPFTDL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |