C9H16FN3 — CID 122169037
1-(2-fluoroethyl)-4-methyl-N-propylpyrazol-5-amine (PubChem CID 122169037) has the molecular formula C9H16FN3 and a molecular weight of 185.25 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-4-methyl-N-propylpyrazol-5-amine.
| Compound Name | 1-(2-fluoroethyl)-4-methyl-N-propylpyrazol-5-amine |
|---|---|
| PubChem CID | 122169037 |
| Molecular Formula | C9H16FN3 |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.13 |
| IUPAC Name | 1-(2-fluoroethyl)-4-methyl-N-propylpyrazol-5-amine |
| SMILES | CCCNc1c(C)cnn1CCF |
| InChI | InChI=1S/C9H16FN3/c1-3-5-11-9-8(2)7-12-13(9)6-4-10/h7,11H,3-6H2,1-2H3 |
| InChIKey | WCWXOZMUWHCREV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |