C14H19ClFN3O — CID 126964046
1-(2-fluoroethyl)-N-[(4-methoxyphenyl)methyl]-4-methylpyrazol-5-amine;hydrochloride (PubChem CID 126964046) has the molecular formula C14H19ClFN3O and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-N-[(4-methoxyphenyl)methyl]-4-methylpyrazol-5-amine;hydrochloride.
| Compound Name | 1-(2-fluoroethyl)-N-[(4-methoxyphenyl)methyl]-4-methylpyrazol-5-amine;hydrochloride |
|---|---|
| PubChem CID | 126964046 |
| Molecular Formula | C14H19ClFN3O |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-(2-fluoroethyl)-N-[(4-methoxyphenyl)methyl]-4-methylpyrazol-5-amine;hydrochloride |
| SMILES | COc1ccc(CNc2c(C)cnn2CCF)cc1.Cl |
| InChI | InChI=1S/C14H18FN3O.ClH/c1-11-9-17-18(8-7-15)14(11)16-10-12-3-5-13(19-2)6-4-12;/h3-6,9,16H,7-8,10H2,1-2H3;1H |
| InChIKey | LGWGHNFWYONQHI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |