C14H22FN5 — CID 122167597
1-(2-fluoroethyl)-4-methyl-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]pyrazol-5-amine (PubChem CID 122167597) has the molecular formula C14H22FN5 and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-(2-fluoroethyl)-4-methyl-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]pyrazol-5-amine.
| Compound Name | 1-(2-fluoroethyl)-4-methyl-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 122167597 |
| Molecular Formula | C14H22FN5 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-(2-fluoroethyl)-4-methyl-N-[[1-(2-methylpropyl)pyrazol-4-yl]methyl]pyrazol-5-amine |
| SMILES | Cc1cnn(CCF)c1NCc1cnn(CC(C)C)c1 |
| InChI | InChI=1S/C14H22FN5/c1-11(2)9-19-10-13(8-17-19)7-16-14-12(3)6-18-20(14)5-4-15/h6,8,10-11,16H,4-5,7,9H2,1-3H3 |
| InChIKey | GEDNQRKBCURVTC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |