C12H15FN4 — CID 103590050
4-fluoro-5-methyl-1-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,2-diamine (PubChem CID 103590050) has the molecular formula C12H15FN4 and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-fluoro-5-methyl-1-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-fluoro-5-methyl-1-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 103590050 |
| Molecular Formula | C12H15FN4 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 4-fluoro-5-methyl-1-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1cc(NCc2cnn(C)c2)c(N)cc1F |
| InChI | InChI=1S/C12H15FN4/c1-8-3-12(11(14)4-10(8)13)15-5-9-6-16-17(2)7-9/h3-4,6-7,15H,5,14H2,1-2H3 |
| InChIKey | RHVILTUMNOOALC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|