C12H13N5O2 — CID 115425272
6-amino-5-[(1-methylpyrazol-4-yl)methylamino]-3H-1,3-benzoxazol-2-one (PubChem CID 115425272) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 6-amino-5-[(1-methylpyrazol-4-yl)methylamino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[(1-methylpyrazol-4-yl)methylamino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425272 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 6-amino-5-[(1-methylpyrazol-4-yl)methylamino]-3H-1,3-benzoxazol-2-one |
| SMILES | Cn1cc(CNc2cc3[nH]c(=O)oc3cc2N)cn1 |
| InChI | InChI=1S/C12H13N5O2/c1-17-6-7(5-15-17)4-14-9-3-10-11(2-8(9)13)19-12(18)16-10/h2-3,5-6,14H,4,13H2,1H3,(H,16,18) |
| InChIKey | KDNAQKYFPGGJGH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 101.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|