C10H13N5O3 — CID 83116004
2-[(6-amino-2-oxo-3H-1,3-benzoxazol-5-yl)amino]ethylurea (PubChem CID 83116004) has the molecular formula C10H13N5O3 and a molecular weight of 251.25 g/mol. Its IUPAC name is 2-[(6-amino-2-oxo-3H-1,3-benzoxazol-5-yl)amino]ethylurea.
| Compound Name | 2-[(6-amino-2-oxo-3H-1,3-benzoxazol-5-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83116004 |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-[(6-amino-2-oxo-3H-1,3-benzoxazol-5-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNc1cc2[nH]c(=O)oc2cc1N |
| InChI | InChI=1S/C10H13N5O3/c11-5-3-8-7(15-10(17)18-8)4-6(5)13-1-2-14-9(12)16/h3-4,13H,1-2,11H2,(H,15,17)(H3,12,14,16) |
| InChIKey | MBWUXHKPNMRPBV-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|