C13H19N3O4 — CID 106250680
6-amino-5-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 106250680) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 6-amino-5-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 106250680 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 6-amino-5-[(2-hydroxy-4-methoxy-2-methylbutyl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | COCCC(C)(O)CNc1cc2[nH]c(=O)oc2cc1N |
| InChI | InChI=1S/C13H19N3O4/c1-13(18,3-4-19-2)7-15-9-6-10-11(5-8(9)14)20-12(17)16-10/h5-6,15,18H,3-4,7,14H2,1-2H3,(H,16,17) |
| InChIKey | UNILRNCWUOTDDU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|