C10H12N2O4 — CID 115425894
6-amino-5-(2-methoxyethoxy)-3H-1,3-benzoxazol-2-one (PubChem CID 115425894) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is 6-amino-5-(2-methoxyethoxy)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(2-methoxyethoxy)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425894 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 6-amino-5-(2-methoxyethoxy)-3H-1,3-benzoxazol-2-one |
| SMILES | COCCOc1cc2[nH]c(=O)oc2cc1N |
| InChI | InChI=1S/C10H12N2O4/c1-14-2-3-15-8-5-7-9(4-6(8)11)16-10(13)12-7/h4-5H,2-3,11H2,1H3,(H,12,13) |
| InChIKey | UOPXQPGYGGIYTM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|