C13H17NO6 — CID 141490122
5,6-bis(2-methoxyethoxy)-3H-1,3-benzoxazol-2-one (PubChem CID 141490122) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 5,6-bis(2-methoxyethoxy)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5,6-bis(2-methoxyethoxy)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 141490122 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 5,6-bis(2-methoxyethoxy)-3H-1,3-benzoxazol-2-one |
| SMILES | COCCOc1cc2[nH]c(=O)oc2cc1OCCOC |
| InChI | InChI=1S/C13H17NO6/c1-16-3-5-18-11-7-9-10(20-13(15)14-9)8-12(11)19-6-4-17-2/h7-8H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | TVEUFROZOATVJA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|