C13H17N3O3 — CID 115425313
6-amino-5-[cyclopropyl(2-methoxyethyl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 115425313) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 6-amino-5-[cyclopropyl(2-methoxyethyl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[cyclopropyl(2-methoxyethyl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425313 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 6-amino-5-[cyclopropyl(2-methoxyethyl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | COCCN(c1cc2[nH]c(=O)oc2cc1N)C1CC1 |
| InChI | InChI=1S/C13H17N3O3/c1-18-5-4-16(8-2-3-8)11-7-10-12(6-9(11)14)19-13(17)15-10/h6-8H,2-5,14H2,1H3,(H,15,17) |
| InChIKey | WGFSVJXOFJYHJG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|