C12H17N3O4 — CID 106243226
6-amino-5-[(3-hydroxy-4-methoxybutyl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 106243226) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 6-amino-5-[(3-hydroxy-4-methoxybutyl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[(3-hydroxy-4-methoxybutyl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 106243226 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 6-amino-5-[(3-hydroxy-4-methoxybutyl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | COCC(O)CCNc1cc2[nH]c(=O)oc2cc1N |
| InChI | InChI=1S/C12H17N3O4/c1-18-6-7(16)2-3-14-9-5-10-11(4-8(9)13)19-12(17)15-10/h4-5,7,14,16H,2-3,6,13H2,1H3,(H,15,17) |
| InChIKey | HCWLDKVDVVBVPV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|