C13H8Cl2N2O3 — CID 115425956
6-amino-5-(3,4-dichlorophenoxy)-3H-1,3-benzoxazol-2-one (PubChem CID 115425956) has the molecular formula C13H8Cl2N2O3 and a molecular weight of 311.12 g/mol. Its IUPAC name is 6-amino-5-(3,4-dichlorophenoxy)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(3,4-dichlorophenoxy)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425956 |
| Molecular Formula | C13H8Cl2N2O3 |
| Molecular Weight | 311.12 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 6-amino-5-(3,4-dichlorophenoxy)-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H8Cl2N2O3/c14-7-2-1-6(3-8(7)15)19-11-5-10-12(4-9(11)16)20-13(18)17-10/h1-5H,16H2,(H,17,18) |
| InChIKey | UWWZKJKQANCPLH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|