C14H12N2O4 — CID 115425969
6-amino-5-[3-(hydroxymethyl)phenoxy]-3H-1,3-benzoxazol-2-one (PubChem CID 115425969) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 6-amino-5-[3-(hydroxymethyl)phenoxy]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[3-(hydroxymethyl)phenoxy]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115425969 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 6-amino-5-[3-(hydroxymethyl)phenoxy]-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1Oc1cccc(CO)c1 |
| InChI | InChI=1S/C14H12N2O4/c15-10-5-13-11(16-14(18)20-13)6-12(10)19-9-3-1-2-8(4-9)7-17/h1-6,17H,7,15H2,(H,16,18) |
| InChIKey | CSWKLLLRIGCBHR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|