C10H12N2O3S — CID 115426090
6-amino-5-(3-hydroxypropylsulfanyl)-3H-1,3-benzoxazol-2-one (PubChem CID 115426090) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 6-amino-5-(3-hydroxypropylsulfanyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(3-hydroxypropylsulfanyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115426090 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 6-amino-5-(3-hydroxypropylsulfanyl)-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1SCCCO |
| InChI | InChI=1S/C10H12N2O3S/c11-6-4-8-7(12-10(14)15-8)5-9(6)16-3-1-2-13/h4-5,13H,1-3,11H2,(H,12,14) |
| InChIKey | IRRSVBRRTILMCI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|