About 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one
6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one (PubChem CID 102924626) has the molecular formula C14H13N3O2S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one |
| PubChem CID | 102924626 |
| Molecular Formula | C14H13N3O2S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one |
| SMILES | Cc1cc(C)nc(Sc2cc3[nH]c(=O)oc3cc2N)c1 |
| InChI | InChI=1S/C14H13N3O2S/c1-7-3-8(2)16-13(4-7)20-12-6-10-11(5-9(12)15)19-14(18)17-10/h3-6H,15H2,1-2H3,(H,17,18) |
| InChIKey | GVUSUNIFXCFVES-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one?
The IUPAC name of 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one (CID 102924626) is 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one is Cc1cc(C)nc(Sc2cc3[nH]c(=O)oc3cc2N)c1.
What is the InChIKey of 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one?
The InChIKey is GVUSUNIFXCFVES-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2S/c1-7-3-8(2)16-13(4-7)20-12-6-10-11(5-9(12)15)19-14(18)17-10/h3-6H,15H2,1-2H3,(H,17,18).
What are the key properties of 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one?
6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one has a molecular weight of 287.34 g/mol, XLogP of 2.87, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-[(4,6-dimethyl-2-pyridinyl)sulfanyl]-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 102924626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).