C11H11N5O2S2 — CID 115426082
6-amino-5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3H-1,3-benzoxazol-2-one (PubChem CID 115426082) has the molecular formula C11H11N5O2S2 and a molecular weight of 309.38 g/mol. Its IUPAC name is 6-amino-5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115426082 |
| Molecular Formula | C11H11N5O2S2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 6-amino-5-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-3H-1,3-benzoxazol-2-one |
| SMILES | CN(C)c1nnc(Sc2cc3[nH]c(=O)oc3cc2N)s1 |
| InChI | InChI=1S/C11H11N5O2S2/c1-16(2)9-14-15-11(20-9)19-8-4-6-7(3-5(8)12)18-10(17)13-6/h3-4H,12H2,1-2H3,(H,13,17) |
| InChIKey | XUSLNEDXJHQIGC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|