C12H15FN4OS2 — CID 63737456
5-(2-amino-5-ethoxy-4-fluorophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine (PubChem CID 63737456) has the molecular formula C12H15FN4OS2 and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-(2-amino-5-ethoxy-4-fluorophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-amino-5-ethoxy-4-fluorophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 63737456 |
| Molecular Formula | C12H15FN4OS2 |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 5-(2-amino-5-ethoxy-4-fluorophenyl)sulfanyl-N,N-dimethyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCOc1cc(Sc2nnc(N(C)C)s2)c(N)cc1F |
| InChI | InChI=1S/C12H15FN4OS2/c1-4-18-9-6-10(8(14)5-7(9)13)19-12-16-15-11(20-12)17(2)3/h5-6H,4,14H2,1-3H3 |
| InChIKey | UDAOVPDARSOICF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|