C11H12FN3O2S — CID 63594501
4-ethoxy-5-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]aniline (PubChem CID 63594501) has the molecular formula C11H12FN3O2S and a molecular weight of 269.30 g/mol. Its IUPAC name is 4-ethoxy-5-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]aniline.
| Compound Name | 4-ethoxy-5-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 63594501 |
| Molecular Formula | C11H12FN3O2S |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-ethoxy-5-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]aniline |
| SMILES | CCOc1cc(Sc2nnc(C)o2)c(N)cc1F |
| InChI | InChI=1S/C11H12FN3O2S/c1-3-16-9-5-10(8(13)4-7(9)12)18-11-15-14-6(2)17-11/h4-5H,3,13H2,1-2H3 |
| InChIKey | FIZLKIVTPYGFRC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|