C12H14FN5OS — CID 63594148
2-(2-amino-5-ethoxy-4-fluorophenyl)sulfanylpyrimidine-4,6-diamine (PubChem CID 63594148) has the molecular formula C12H14FN5OS and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(2-amino-5-ethoxy-4-fluorophenyl)sulfanylpyrimidine-4,6-diamine.
| Compound Name | 2-(2-amino-5-ethoxy-4-fluorophenyl)sulfanylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 63594148 |
| Molecular Formula | C12H14FN5OS |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-(2-amino-5-ethoxy-4-fluorophenyl)sulfanylpyrimidine-4,6-diamine |
| SMILES | CCOc1cc(Sc2nc(N)cc(N)n2)c(N)cc1F |
| InChI | InChI=1S/C12H14FN5OS/c1-2-19-8-4-9(7(14)3-6(8)13)20-12-17-10(15)5-11(16)18-12/h3-5H,2,14H2,1H3,(H4,15,16,17,18) |
| InChIKey | GHLXAKMLWNOMNI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 113.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|