C11H11N5O2 — CID 113307392
6-amino-5-(1H-pyrazol-5-ylmethylamino)-3H-1,3-benzoxazol-2-one (PubChem CID 113307392) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 6-amino-5-(1H-pyrazol-5-ylmethylamino)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-(1H-pyrazol-5-ylmethylamino)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 113307392 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 6-amino-5-(1H-pyrazol-5-ylmethylamino)-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1NCc1ccn[nH]1 |
| InChI | InChI=1S/C11H11N5O2/c12-7-3-10-9(15-11(17)18-10)4-8(7)13-5-6-1-2-14-16-6/h1-4,13H,5,12H2,(H,14,16)(H,15,17) |
| InChIKey | BUNTZOYRTKCHFR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|