C10H13N5 — CID 61350597
4-N-[(1-methylpyrazol-4-yl)methyl]pyridine-3,4-diamine (PubChem CID 61350597) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 4-N-[(1-methylpyrazol-4-yl)methyl]pyridine-3,4-diamine.
| Compound Name | 4-N-[(1-methylpyrazol-4-yl)methyl]pyridine-3,4-diamine |
|---|---|
| PubChem CID | 61350597 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-N-[(1-methylpyrazol-4-yl)methyl]pyridine-3,4-diamine |
| SMILES | Cn1cc(CNc2ccncc2N)cn1 |
| InChI | InChI=1S/C10H13N5/c1-15-7-8(5-14-15)4-13-10-2-3-12-6-9(10)11/h2-3,5-7H,4,11H2,1H3,(H,12,13) |
| InChIKey | ULQLPBHEMGFCKL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |