C12H16N4 — CID 61350782
2-methyl-1-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,4-diamine (PubChem CID 61350782) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-methyl-1-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,4-diamine.
| Compound Name | 2-methyl-1-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 61350782 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-methyl-1-N-[(1-methylpyrazol-4-yl)methyl]benzene-1,4-diamine |
| SMILES | Cc1cc(N)ccc1NCc1cnn(C)c1 |
| InChI | InChI=1S/C12H16N4/c1-9-5-11(13)3-4-12(9)14-6-10-7-15-16(2)8-10/h3-5,7-8,14H,6,13H2,1-2H3 |
| InChIKey | JNQNSMGTYUEJSO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|