About 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride
1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride (PubChem CID 126964844) has the molecular formula C15H18ClF2N3
and a molecular weight of 313.78 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride |
| PubChem CID | 126964844 |
| Molecular Formula | C15H18ClF2N3 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride |
| SMILES | Cl.Fc1ccc(F)c(CNc2cnn(C3CCCC3)c2)c1 |
| InChI | InChI=1S/C15H17F2N3.ClH/c16-12-5-6-15(17)11(7-12)8-18-13-9-19-20(10-13)14-3-1-2-4-14;/h5-7,9-10,14,18H,1-4,8H2;1H |
| InChIKey | VAISWRLPTNOYEZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride?
The IUPAC name of 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride (CID 126964844) is 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride.
What is the SMILES notation for 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride?
The canonical SMILES for 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride is Cl.Fc1ccc(F)c(CNc2cnn(C3CCCC3)c2)c1.
What is the InChIKey of 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride?
The InChIKey is VAISWRLPTNOYEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F2N3.ClH/c16-12-5-6-15(17)11(7-12)8-18-13-9-19-20(10-13)14-3-1-2-4-14;/h5-7,9-10,14,18H,1-4,8H2;1H.
What are the key properties of 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride?
1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride has a molecular weight of 313.78 g/mol, XLogP of 4.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-[(2,5-difluorophenyl)methyl]pyrazol-4-amine;hydrochloride is sourced from PubChem (CID 126964844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).