C12H16ClN3O2 — CID 126965069
4-[[(1,4-dimethylpyrazol-5-yl)amino]methyl]benzene-1,3-diol;hydrochloride (PubChem CID 126965069) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 4-[[(1,4-dimethylpyrazol-5-yl)amino]methyl]benzene-1,3-diol;hydrochloride.
| Compound Name | 4-[[(1,4-dimethylpyrazol-5-yl)amino]methyl]benzene-1,3-diol;hydrochloride |
|---|---|
| PubChem CID | 126965069 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-[[(1,4-dimethylpyrazol-5-yl)amino]methyl]benzene-1,3-diol;hydrochloride |
| SMILES | Cc1cnn(C)c1NCc1ccc(O)cc1O.Cl |
| InChI | InChI=1S/C12H15N3O2.ClH/c1-8-6-14-15(2)12(8)13-7-9-3-4-10(16)5-11(9)17;/h3-6,13,16-17H,7H2,1-2H3;1H |
| InChIKey | JAKZTYXARRPPTI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|