C11H21ClFN3O — CID 126965471
3-ethoxy-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine;hydrochloride (PubChem CID 126965471) has the molecular formula C11H21ClFN3O and a molecular weight of 265.76 g/mol. Its IUPAC name is 3-ethoxy-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine;hydrochloride.
| Compound Name | 3-ethoxy-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 126965471 |
| Molecular Formula | C11H21ClFN3O |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 3-ethoxy-N-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine;hydrochloride |
| SMILES | CCOCCCNCc1c(C)nn(C)c1F.Cl |
| InChI | InChI=1S/C11H20FN3O.ClH/c1-4-16-7-5-6-13-8-10-9(2)14-15(3)11(10)12;/h13H,4-8H2,1-3H3;1H |
| InChIKey | MFKPUMOBVCLYSH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|