C10H19ClFN3O — CID 126965357
4-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylamino]butan-1-ol;hydrochloride (PubChem CID 126965357) has the molecular formula C10H19ClFN3O and a molecular weight of 251.73 g/mol. Its IUPAC name is 4-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylamino]butan-1-ol;hydrochloride.
| Compound Name | 4-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 126965357 |
| Molecular Formula | C10H19ClFN3O |
| Molecular Weight | 251.73 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-[(5-fluoro-1,3-dimethylpyrazol-4-yl)methylamino]butan-1-ol;hydrochloride |
| SMILES | Cc1nn(C)c(F)c1CNCCCCO.Cl |
| InChI | InChI=1S/C10H18FN3O.ClH/c1-8-9(10(11)14(2)13-8)7-12-5-3-4-6-15;/h12,15H,3-7H2,1-2H3;1H |
| InChIKey | FYDHPVRNWTYNDT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.73 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|