C16H30N4O — CID 102864776
3-[cyclobutyl-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]amino]propan-1-ol (PubChem CID 102864776) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is 3-[cyclobutyl-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]amino]propan-1-ol.
| Compound Name | 3-[cyclobutyl-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 102864776 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 3-[cyclobutyl-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]amino]propan-1-ol |
| SMILES | CCCNCc1c(C)nn(C)c1N(CCCO)C1CCC1 |
| InChI | InChI=1S/C16H30N4O/c1-4-9-17-12-15-13(2)18-19(3)16(15)20(10-6-11-21)14-7-5-8-14/h14,17,21H,4-12H2,1-3H3 |
| InChIKey | JHXSPANDROLWTF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|