About N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine
N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine (PubChem CID 43280836) has the molecular formula C16H30N4
and a molecular weight of 278.44 g/mol. Its IUPAC name is N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine |
| PubChem CID | 43280836 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine |
| SMILES | CCCNCc1c(C)nn(C)c1N(C)C1CCCCC1 |
| InChI | InChI=1S/C16H30N4/c1-5-11-17-12-15-13(2)18-20(4)16(15)19(3)14-9-7-6-8-10-14/h14,17H,5-12H2,1-4H3 |
| InChIKey | MNIDREFVRHVMNC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine?
The IUPAC name of N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine (CID 43280836) is N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine.
What is the SMILES notation for N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine?
The canonical SMILES for N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine is CCCNCc1c(C)nn(C)c1N(C)C1CCCCC1.
What is the InChIKey of N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine?
The InChIKey is MNIDREFVRHVMNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4/c1-5-11-17-12-15-13(2)18-20(4)16(15)19(3)14-9-7-6-8-10-14/h14,17H,5-12H2,1-4H3.
What are the key properties of N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine?
N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine has a molecular weight of 278.44 g/mol, XLogP of 3.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-N,1,3-trimethyl-4-(propylaminomethyl)pyrazol-5-amine is sourced from PubChem (CID 43280836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).