About 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine
4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine (PubChem CID 61447122) has the molecular formula C16H30N4
and a molecular weight of 278.44 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine |
| PubChem CID | 61447122 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine |
| SMILES | CCNCc1c(C)nn(C)c1N(C)C1CCCC(C)C1 |
| InChI | InChI=1S/C16H30N4/c1-6-17-11-15-13(3)18-20(5)16(15)19(4)14-9-7-8-12(2)10-14/h12,14,17H,6-11H2,1-5H3 |
| InChIKey | XVYIQUUEEHRXNG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine?
The IUPAC name of 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine (CID 61447122) is 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine.
What is the SMILES notation for 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine?
The canonical SMILES for 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine is CCNCc1c(C)nn(C)c1N(C)C1CCCC(C)C1.
What is the InChIKey of 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine?
The InChIKey is XVYIQUUEEHRXNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N4/c1-6-17-11-15-13(3)18-20(5)16(15)19(4)14-9-7-8-12(2)10-14/h12,14,17H,6-11H2,1-5H3.
What are the key properties of 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine?
4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine has a molecular weight of 278.44 g/mol, XLogP of 2.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylaminomethyl)-N,1,3-trimethyl-N-(3-methylcyclohexyl)pyrazol-5-amine is sourced from PubChem (CID 61447122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).