About 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide
2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide (PubChem CID 43375197) has the molecular formula C14H27N5O
and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide |
| PubChem CID | 43375197 |
| Molecular Formula | C14H27N5O |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide |
| SMILES | CCCNCc1c(C)nn(C)c1N(C)CC(=O)N(C)C |
| InChI | InChI=1S/C14H27N5O/c1-7-8-15-9-12-11(2)16-19(6)14(12)18(5)10-13(20)17(3)4/h15H,7-10H2,1-6H3 |
| InChIKey | SRRFDSJIXFBMPR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide?
The IUPAC name of 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide (CID 43375197) is 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide is CCCNCc1c(C)nn(C)c1N(C)CC(=O)N(C)C.
What is the InChIKey of 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide?
The InChIKey is SRRFDSJIXFBMPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N5O/c1-7-8-15-9-12-11(2)16-19(6)14(12)18(5)10-13(20)17(3)4/h15H,7-10H2,1-6H3.
What are the key properties of 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide?
2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide has a molecular weight of 281.40 g/mol, XLogP of 0.75, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]-methylamino]-N,N-dimethylacetamide is sourced from PubChem (CID 43375197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).