C13H24F2N4O — CID 107481446
2-[2,2-difluoroethyl-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]amino]ethanol (PubChem CID 107481446) has the molecular formula C13H24F2N4O and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[2,2-difluoroethyl-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]amino]ethanol.
| Compound Name | 2-[2,2-difluoroethyl-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 107481446 |
| Molecular Formula | C13H24F2N4O |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 2-[2,2-difluoroethyl-[1,3-dimethyl-4-(propylaminomethyl)pyrazol-5-yl]amino]ethanol |
| SMILES | CCCNCc1c(C)nn(C)c1N(CCO)CC(F)F |
| InChI | InChI=1S/C13H24F2N4O/c1-4-5-16-8-11-10(2)17-18(3)13(11)19(6-7-20)9-12(14)15/h12,16,20H,4-9H2,1-3H3 |
| InChIKey | NLNCAVKYJZWPEK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|