C13H18ClN3O — CID 126965558
2-[[(1-propylpyrazol-4-yl)amino]methyl]phenol;hydrochloride (PubChem CID 126965558) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-[[(1-propylpyrazol-4-yl)amino]methyl]phenol;hydrochloride.
| Compound Name | 2-[[(1-propylpyrazol-4-yl)amino]methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 126965558 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-[[(1-propylpyrazol-4-yl)amino]methyl]phenol;hydrochloride |
| SMILES | CCCn1cc(NCc2ccccc2O)cn1.Cl |
| InChI | InChI=1S/C13H17N3O.ClH/c1-2-7-16-10-12(9-15-16)14-8-11-5-3-4-6-13(11)17;/h3-6,9-10,14,17H,2,7-8H2,1H3;1H |
| InChIKey | XODSWLAROGOUMD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|