C13H16FN3O2 — CID 103947895
4-fluoro-2-[[[1-(2-methoxyethyl)pyrazol-4-yl]amino]methyl]phenol (PubChem CID 103947895) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-fluoro-2-[[[1-(2-methoxyethyl)pyrazol-4-yl]amino]methyl]phenol.
| Compound Name | 4-fluoro-2-[[[1-(2-methoxyethyl)pyrazol-4-yl]amino]methyl]phenol |
|---|---|
| PubChem CID | 103947895 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 4-fluoro-2-[[[1-(2-methoxyethyl)pyrazol-4-yl]amino]methyl]phenol |
| SMILES | COCCn1cc(NCc2cc(F)ccc2O)cn1 |
| InChI | InChI=1S/C13H16FN3O2/c1-19-5-4-17-9-12(8-16-17)15-7-10-6-11(14)2-3-13(10)18/h2-3,6,8-9,15,18H,4-5,7H2,1H3 |
| InChIKey | PYNZKOZSJRCZNB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|